C31H35ClN2O4 — CID 133231711
N-butyl-2-[(4-chlorophenyl)methyl-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 133231711) has the molecular formula C31H35ClN2O4 and a molecular weight of 535.08 g/mol. Its IUPAC name is N-butyl-2-[(4-chlorophenyl)methyl-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(4-chlorophenyl)methyl-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133231711 |
| Molecular Formula | C31H35ClN2O4 |
| Molecular Weight | 535.08 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N-butyl-2-[(4-chlorophenyl)methyl-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C31H35ClN2O4/c1-2-3-17-33-31(36)27(20-23-7-5-4-6-8-23)34(22-25-9-13-26(32)14-10-25)30(35)16-12-24-11-15-28-29(21-24)38-19-18-37-28/h4-11,13-15,21,27H,2-3,12,16-20,22H2,1H3,(H,33,36) |
| InChIKey | JCICINIDWYESDF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|