C31H37ClN2O4 — CID 100640149
(2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 100640149) has the molecular formula C31H37ClN2O4 and a molecular weight of 537.10 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100640149 |
| Molecular Formula | C31H37ClN2O4 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(3,4-dimethoxyphenyl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H37ClN2O4/c1-4-5-19-33-31(36)27(20-23-9-7-6-8-10-23)34(22-25-11-15-26(32)16-12-25)30(35)18-14-24-13-17-28(37-2)29(21-24)38-3/h6-13,15-17,21,27H,4-5,14,18-20,22H2,1-3H3,(H,33,36)/t27-/m1/s1 |
| InChIKey | HGGSQVNMTVGPKN-HHHXNRCGSA-N |
| XLogP | 5.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|