C33H40Cl2N2O4 — CID 133207264
N-butyl-2-[(3,4-dichlorophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 133207264) has the molecular formula C33H40Cl2N2O4 and a molecular weight of 599.60 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207264 |
| Molecular Formula | C33H40Cl2N2O4 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C33H40Cl2N2O4/c1-4-7-19-36-33(39)29(21-24-11-9-8-10-12-24)37(23-26-13-16-27(34)28(35)20-26)32(38)18-15-25-14-17-30(40-5-2)31(22-25)41-6-3/h8-14,16-17,20,22,29H,4-7,15,18-19,21,23H2,1-3H3,(H,36,39) |
| InChIKey | IXFXOAMZBOWFOG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|