C33H41BrN2O4 — CID 100670299
(2S)-2-[(3-bromophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100670299) has the molecular formula C33H41BrN2O4 and a molecular weight of 609.61 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100670299 |
| Molecular Formula | C33H41BrN2O4 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[3-(3,4-diethoxyphenyl)propanoyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C33H41BrN2O4/c1-4-7-20-35-33(38)29(22-25-12-9-8-10-13-25)36(24-27-14-11-15-28(34)21-27)32(37)19-17-26-16-18-30(39-5-2)31(23-26)40-6-3/h8-16,18,21,23,29H,4-7,17,19-20,22,24H2,1-3H3,(H,35,38)/t29-/m0/s1 |
| InChIKey | PAUISPOWIWKONC-LJAQVGFWSA-N |
| XLogP | 6.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|