C34H44N2O4 — CID 133153346
N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133153346) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133153346 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C34H44N2O4/c1-5-8-21-35-34(38)30(23-27-14-10-9-11-15-27)36(25-29-16-12-13-26(4)22-29)33(37)20-18-28-17-19-31(39-6-2)32(24-28)40-7-3/h9-17,19,22,24,30H,5-8,18,20-21,23,25H2,1-4H3,(H,35,38) |
| InChIKey | UMCMLDKSQVSFCX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|