C29H42N2O4 — CID 132986815
N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(4-methylphenyl)methyl]amino]butanamide (PubChem CID 132986815) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(4-methylphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(4-methylphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132986815 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(4-methylphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(C)cc1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C29H42N2O4/c1-6-10-19-30-29(33)25(7-2)31(21-24-13-11-22(5)12-14-24)28(32)18-16-23-15-17-26(34-8-3)27(20-23)35-9-4/h11-15,17,20,25H,6-10,16,18-19,21H2,1-5H3,(H,30,33) |
| InChIKey | PQEWKRCHNYCCFH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|