C34H44N2O5 — CID 100712194
(2R)-N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100712194) has the molecular formula C34H44N2O5 and a molecular weight of 560.74 g/mol. Its IUPAC name is (2R)-N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100712194 |
| Molecular Formula | C34H44N2O5 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (2R)-N-butyl-2-[3-(3,4-diethoxyphenyl)propanoyl-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C34H44N2O5/c1-5-8-21-35-34(38)30(23-26-13-10-9-11-14-26)36(25-28-15-12-16-29(22-28)39-4)33(37)20-18-27-17-19-31(40-6-2)32(24-27)41-7-3/h9-17,19,22,24,30H,5-8,18,20-21,23,25H2,1-4H3,(H,35,38)/t30-/m1/s1 |
| InChIKey | DKLSDTMJPZTIFP-SSEXGKCCSA-N |
| XLogP | 5.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|