C29H31Cl3N2O2 — CID 100696634
(2R)-N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100696634) has the molecular formula C29H31Cl3N2O2 and a molecular weight of 545.94 g/mol. Its IUPAC name is (2R)-N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100696634 |
| Molecular Formula | C29H31Cl3N2O2 |
| Molecular Weight | 545.94 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | (2R)-N-butyl-2-[3-(2-chlorophenyl)propanoyl-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C29H31Cl3N2O2/c1-2-3-17-33-29(36)27(19-21-9-5-4-6-10-21)34(20-22-13-15-25(31)26(32)18-22)28(35)16-14-23-11-7-8-12-24(23)30/h4-13,15,18,27H,2-3,14,16-17,19-20H2,1H3,(H,33,36)/t27-/m1/s1 |
| InChIKey | DVFHPFJDKDJSRU-HHHXNRCGSA-N |
| XLogP | 7.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.94 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|