C29H32Cl2N2O2 — CID 100606220
(2R)-N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100606220) has the molecular formula C29H32Cl2N2O2 and a molecular weight of 511.49 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100606220 |
| Molecular Formula | C29H32Cl2N2O2 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(3,4-dichlorophenyl)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H32Cl2N2O2/c1-3-4-16-32-29(35)27(18-22-8-6-5-7-9-22)33(20-23-12-10-21(2)11-13-23)28(34)19-24-14-15-25(30)26(31)17-24/h5-15,17,27H,3-4,16,18-20H2,1-2H3,(H,32,35)/t27-/m1/s1 |
| InChIKey | NNLXBXSVFLJGIV-HHHXNRCGSA-N |
| XLogP | 6.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|