C28H29BrCl2N2O2 — CID 100671631
(2R)-2-[(3-bromophenyl)methyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100671631) has the molecular formula C28H29BrCl2N2O2 and a molecular weight of 576.36 g/mol. Its IUPAC name is (2R)-2-[(3-bromophenyl)methyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-bromophenyl)methyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100671631 |
| Molecular Formula | C28H29BrCl2N2O2 |
| Molecular Weight | 576.36 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | (2R)-2-[(3-bromophenyl)methyl-[2-(3,4-dichlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H29BrCl2N2O2/c1-2-3-14-32-28(35)26(17-20-8-5-4-6-9-20)33(19-22-10-7-11-23(29)15-22)27(34)18-21-12-13-24(30)25(31)16-21/h4-13,15-16,26H,2-3,14,17-19H2,1H3,(H,32,35)/t26-/m1/s1 |
| InChIKey | LLJHCOUAMXBCGV-AREMUKBSSA-N |
| XLogP | 6.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.36 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|