C28H30BrClN2O2 — CID 100671570
(2S)-2-[(3-bromophenyl)methyl-[2-(2-chlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100671570) has the molecular formula C28H30BrClN2O2 and a molecular weight of 541.92 g/mol. Its IUPAC name is (2S)-2-[(3-bromophenyl)methyl-[2-(2-chlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2-chlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100671570 |
| Molecular Formula | C28H30BrClN2O2 |
| Molecular Weight | 541.92 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (2S)-2-[(3-bromophenyl)methyl-[2-(2-chlorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C28H30BrClN2O2/c1-2-3-16-31-28(34)26(18-21-10-5-4-6-11-21)32(20-22-12-9-14-24(29)17-22)27(33)19-23-13-7-8-15-25(23)30/h4-15,17,26H,2-3,16,18-20H2,1H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | GSJZUBFPNVYBDY-SANMLTNESA-N |
| XLogP | 6.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|