C28H30Cl2N2O2 — CID 133258771
N-butyl-2-[[2-(2-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133258771) has the molecular formula C28H30Cl2N2O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(2-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133258771 |
| Molecular Formula | C28H30Cl2N2O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-butyl-2-[[2-(2-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C28H30Cl2N2O2/c1-2-3-17-31-28(34)26(18-21-9-5-4-6-10-21)32(20-22-13-15-24(29)16-14-22)27(33)19-23-11-7-8-12-25(23)30/h4-16,26H,2-3,17-20H2,1H3,(H,31,34) |
| InChIKey | ZMUOAOXIHPHYIH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|