C28H29BrCl2N2O3 — CID 133207081
2-[[2-(4-bromophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133207081) has the molecular formula C28H29BrCl2N2O3 and a molecular weight of 592.36 g/mol. Its IUPAC name is 2-[[2-(4-bromophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(4-bromophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207081 |
| Molecular Formula | C28H29BrCl2N2O3 |
| Molecular Weight | 592.36 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | 2-[[2-(4-bromophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H29BrCl2N2O3/c1-2-3-15-32-28(35)26(17-20-7-5-4-6-8-20)33(18-21-9-14-24(30)25(31)16-21)27(34)19-36-23-12-10-22(29)11-13-23/h4-14,16,26H,2-3,15,17-19H2,1H3,(H,32,35) |
| InChIKey | UTJGHRAAOULZSF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.36 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|