C30H34Cl2N2O5 — CID 133207248
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133207248) has the molecular formula C30H34Cl2N2O5 and a molecular weight of 573.52 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207248 |
| Molecular Formula | C30H34Cl2N2O5 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C30H34Cl2N2O5/c1-4-5-13-33-30(36)28(15-21-9-7-6-8-10-21)34(19-22-11-12-26(31)27(32)14-22)29(35)20-39-25-17-23(37-2)16-24(18-25)38-3/h6-12,14,16-18,28H,4-5,13,15,19-20H2,1-3H3,(H,33,36) |
| InChIKey | OAMYZBLEKUKPDF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|