C30H35ClN2O5 — CID 100626798
(2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100626798) has the molecular formula C30H35ClN2O5 and a molecular weight of 539.07 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100626798 |
| Molecular Formula | C30H35ClN2O5 |
| Molecular Weight | 539.07 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C30H35ClN2O5/c1-4-5-14-32-30(35)28(16-22-10-7-6-8-11-22)33(20-23-12-9-13-24(31)15-23)29(34)21-38-27-18-25(36-2)17-26(19-27)37-3/h6-13,15,17-19,28H,4-5,14,16,20-21H2,1-3H3,(H,32,35)/t28-/m0/s1 |
| InChIKey | GFWADOBSPPSLAU-NDEPHWFRSA-N |
| XLogP | 5.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.07 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|