C29H33ClN2O4 — CID 100616758
(2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100616758) has the molecular formula C29H33ClN2O4 and a molecular weight of 509.05 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100616758 |
| Molecular Formula | C29H33ClN2O4 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (2R)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)COc1ccccc1OC |
| InChI | InChI=1S/C29H33ClN2O4/c1-3-4-17-31-29(34)25(19-22-11-6-5-7-12-22)32(20-23-13-10-14-24(30)18-23)28(33)21-36-27-16-9-8-15-26(27)35-2/h5-16,18,25H,3-4,17,19-21H2,1-2H3,(H,31,34)/t25-/m1/s1 |
| InChIKey | QUUQGJZQRJYLAF-RUZDIDTESA-N |
| XLogP | 5.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|