C31H36Cl2N2O3 — CID 100694736
N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide (PubChem CID 100694736) has the molecular formula C31H36Cl2N2O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 100694736 |
| Molecular Formula | C31H36Cl2N2O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[(2S)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C31H36Cl2N2O3/c1-3-4-18-34-31(37)29(21-24-9-6-5-7-10-24)35(22-25-14-17-27(32)28(33)20-25)30(36)11-8-19-38-26-15-12-23(2)13-16-26/h5-7,9-10,12-17,20,29H,3-4,8,11,18-19,21-22H2,1-2H3,(H,34,37)/t29-/m0/s1 |
| InChIKey | WSRAQNBIIYDSBQ-LJAQVGFWSA-N |
| XLogP | 7.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|