C25H31Cl3N2O3 — CID 132729227
N-butyl-2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]butanamide (PubChem CID 132729227) has the molecular formula C25H31Cl3N2O3 and a molecular weight of 513.89 g/mol. Its IUPAC name is N-butyl-2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132729227 |
| Molecular Formula | C25H31Cl3N2O3 |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-butyl-2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31Cl3N2O3/c1-3-5-14-29-25(32)23(4-2)30(17-18-8-13-21(27)22(28)16-18)24(31)7-6-15-33-20-11-9-19(26)10-12-20/h8-13,16,23H,3-7,14-15,17H2,1-2H3,(H,29,32) |
| InChIKey | NBZZVVBSMQAANM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|