C24H29Cl3N2O3 — CID 132947097
2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-propan-2-ylbutanamide (PubChem CID 132947097) has the molecular formula C24H29Cl3N2O3 and a molecular weight of 499.87 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-propan-2-ylbutanamide.
| Compound Name | 2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 132947097 |
| Molecular Formula | C24H29Cl3N2O3 |
| Molecular Weight | 499.87 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)butanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29Cl3N2O3/c1-4-22(24(31)28-16(2)3)29(15-17-7-12-20(26)21(27)14-17)23(30)6-5-13-32-19-10-8-18(25)9-11-19/h7-12,14,16,22H,4-6,13,15H2,1-3H3,(H,28,31) |
| InChIKey | ONBCYJYVORECSF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.87 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|