C25H32Cl2N2O4 — CID 100588328
N-[(2R)-1-[[(2R)-butan-2-yl]amino]-1-oxopropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 100588328) has the molecular formula C25H32Cl2N2O4 and a molecular weight of 495.45 g/mol. Its IUPAC name is N-[(2R)-1-[[(2R)-butan-2-yl]amino]-1-oxopropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-[(2R)-1-[[(2R)-butan-2-yl]amino]-1-oxopropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 100588328 |
| Molecular Formula | C25H32Cl2N2O4 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[(2R)-1-[[(2R)-butan-2-yl]amino]-1-oxopropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H32Cl2N2O4/c1-5-17(2)28-25(31)18(3)29(16-19-8-13-22(26)23(27)15-19)24(30)7-6-14-33-21-11-9-20(32-4)10-12-21/h8-13,15,17-18H,5-7,14,16H2,1-4H3,(H,28,31)/t17-,18-/m1/s1 |
| InChIKey | OCDABSWPRRERBJ-QZTJIDSGSA-N |
| XLogP | 5.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|