C24H30Cl2N2O4 — CID 100507842
N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]butanamide (PubChem CID 100507842) has the molecular formula C24H30Cl2N2O4 and a molecular weight of 481.42 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]butanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 100507842 |
| Molecular Formula | C24H30Cl2N2O4 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-4-(4-methoxyphenoxy)-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]butanamide |
| SMILES | CCCNC(=O)[C@H](C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30Cl2N2O4/c1-4-13-27-24(30)17(2)28(16-18-7-12-21(25)22(26)15-18)23(29)6-5-14-32-20-10-8-19(31-3)9-11-20/h7-12,15,17H,4-6,13-14,16H2,1-3H3,(H,27,30)/t17-/m0/s1 |
| InChIKey | USOBQEWYHITROD-KRWDZBQOSA-N |
| XLogP | 5.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|