C31H36Cl2N2O3 — CID 133259862
N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide (PubChem CID 133259862) has the molecular formula C31H36Cl2N2O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 133259862 |
| Molecular Formula | C31H36Cl2N2O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-[1-(butan-2-ylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3,4-dichlorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C31H36Cl2N2O3/c1-4-23(3)34-31(37)29(20-24-9-6-5-7-10-24)35(21-25-14-17-27(32)28(33)19-25)30(36)11-8-18-38-26-15-12-22(2)13-16-26/h5-7,9-10,12-17,19,23,29H,4,8,11,18,20-21H2,1-3H3,(H,34,37) |
| InChIKey | JVGDGOQJUPCESQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|