C28H29Cl2IN2O3 — CID 133259924
N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133259924) has the molecular formula C28H29Cl2IN2O3 and a molecular weight of 639.36 g/mol. Its IUPAC name is N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133259924 |
| Molecular Formula | C28H29Cl2IN2O3 |
| Molecular Weight | 639.36 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | N-butan-2-yl-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCC(C)NC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C28H29Cl2IN2O3/c1-3-19(2)32-28(35)26(16-20-7-5-4-6-8-20)33(17-21-9-14-24(29)25(30)15-21)27(34)18-36-23-12-10-22(31)11-13-23/h4-15,19,26H,3,16-18H2,1-2H3,(H,32,35) |
| InChIKey | PWQRJTDNRVXZSE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.36 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|