C23H27Cl2IN2O3 — CID 100733835
(2S)-N-[(2S)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide (PubChem CID 100733835) has the molecular formula C23H27Cl2IN2O3 and a molecular weight of 577.29 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 100733835 |
| Molecular Formula | C23H27Cl2IN2O3 |
| Molecular Weight | 577.29 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C23H27Cl2IN2O3/c1-4-15(3)27-23(30)21(5-2)28(13-16-6-11-19(24)20(25)12-16)22(29)14-31-18-9-7-17(26)8-10-18/h6-12,15,21H,4-5,13-14H2,1-3H3,(H,27,30)/t15-,21-/m0/s1 |
| InChIKey | LHLCFIMINGMGJY-BTYIYWSLSA-N |
| XLogP | 5.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.29 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|