C22H25Cl2IN2O3 — CID 100589927
(2R)-N-[(2R)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide (PubChem CID 100589927) has the molecular formula C22H25Cl2IN2O3 and a molecular weight of 563.26 g/mol. Its IUPAC name is (2R)-N-[(2R)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide.
| Compound Name | (2R)-N-[(2R)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100589927 |
| Molecular Formula | C22H25Cl2IN2O3 |
| Molecular Weight | 563.26 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | (2R)-N-[(2R)-butan-2-yl]-2-[(3,4-dichlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C22H25Cl2IN2O3/c1-4-14(2)26-22(29)15(3)27(12-16-5-10-19(23)20(24)11-16)21(28)13-30-18-8-6-17(25)7-9-18/h5-11,14-15H,4,12-13H2,1-3H3,(H,26,29)/t14-,15-/m1/s1 |
| InChIKey | ZCUXZQGTZSZBLZ-HUUCEWRRSA-N |
| XLogP | 5.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.26 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|