C22H26FIN2O3 — CID 100574307
(2R)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide (PubChem CID 100574307) has the molecular formula C22H26FIN2O3 and a molecular weight of 512.36 g/mol. Its IUPAC name is (2R)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide.
| Compound Name | (2R)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100574307 |
| Molecular Formula | C22H26FIN2O3 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (2R)-N-[(2R)-butan-2-yl]-2-[(4-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)N(Cc1ccc(F)cc1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C22H26FIN2O3/c1-4-15(2)25-22(28)16(3)26(13-17-5-7-18(23)8-6-17)21(27)14-29-20-11-9-19(24)10-12-20/h5-12,15-16H,4,13-14H2,1-3H3,(H,25,28)/t15-,16-/m1/s1 |
| InChIKey | WWZYAIGHILARFN-HZPDHXFCSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|