C31H37ClN2O2 — CID 100640258
(2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 100640258) has the molecular formula C31H37ClN2O2 and a molecular weight of 505.10 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100640258 |
| Molecular Formula | C31H37ClN2O2 |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[3-(4-ethylphenyl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CCc1ccc(CC)cc1 |
| InChI | InChI=1S/C31H37ClN2O2/c1-3-5-21-33-31(36)29(22-26-9-7-6-8-10-26)34(23-27-15-18-28(32)19-16-27)30(35)20-17-25-13-11-24(4-2)12-14-25/h6-16,18-19,29H,3-5,17,20-23H2,1-2H3,(H,33,36)/t29-/m1/s1 |
| InChIKey | WSTYKKHGJTTXLN-GDLZYMKVSA-N |
| XLogP | 6.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|