C31H38N2O2 — CID 100603460
(2R)-N-butyl-2-[(4-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]-3-phenylpropanamide (PubChem CID 100603460) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(4-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(4-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100603460 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2R)-N-butyl-2-[(4-methylphenyl)methyl-[3-(4-methylphenyl)propanoyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C31H38N2O2/c1-4-5-21-32-31(35)29(22-27-9-7-6-8-10-27)33(23-28-17-13-25(3)14-18-28)30(34)20-19-26-15-11-24(2)12-16-26/h6-18,29H,4-5,19-23H2,1-3H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | AAWZKGKNLAPNOD-GDLZYMKVSA-N |
| XLogP | 5.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|