C31H38N2O2S — CID 100604448
(2S)-2-[3-benzylsulfanylpropanoyl-[(4-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100604448) has the molecular formula C31H38N2O2S and a molecular weight of 502.72 g/mol. Its IUPAC name is (2S)-2-[3-benzylsulfanylpropanoyl-[(4-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[3-benzylsulfanylpropanoyl-[(4-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100604448 |
| Molecular Formula | C31H38N2O2S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (2S)-2-[3-benzylsulfanylpropanoyl-[(4-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C31H38N2O2S/c1-3-4-20-32-31(35)29(22-26-11-7-5-8-12-26)33(23-27-17-15-25(2)16-18-27)30(34)19-21-36-24-28-13-9-6-10-14-28/h5-18,29H,3-4,19-24H2,1-2H3,(H,32,35)/t29-/m0/s1 |
| InChIKey | WKQXWEQTCAUVEH-LJAQVGFWSA-N |
| XLogP | 6.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|