C31H38N2O3S — CID 100598963
(2R)-N-butyl-2-[[2-[(4-methoxyphenyl)methylsulfanyl]acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100598963) has the molecular formula C31H38N2O3S and a molecular weight of 518.72 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-[(4-methoxyphenyl)methylsulfanyl]acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-[(4-methoxyphenyl)methylsulfanyl]acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100598963 |
| Molecular Formula | C31H38N2O3S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (2R)-N-butyl-2-[[2-[(4-methoxyphenyl)methylsulfanyl]acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)CSCc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H38N2O3S/c1-4-5-19-32-31(35)29(20-25-9-7-6-8-10-25)33(21-26-13-11-24(2)12-14-26)30(34)23-37-22-27-15-17-28(36-3)18-16-27/h6-18,29H,4-5,19-23H2,1-3H3,(H,32,35)/t29-/m1/s1 |
| InChIKey | WDXYVWXYTIKVJS-GDLZYMKVSA-N |
| XLogP | 5.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|