C30H35FN2O2S — CID 100650154
(2R)-2-[3-benzylsulfanylpropanoyl-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100650154) has the molecular formula C30H35FN2O2S and a molecular weight of 506.69 g/mol. Its IUPAC name is (2R)-2-[3-benzylsulfanylpropanoyl-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[3-benzylsulfanylpropanoyl-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100650154 |
| Molecular Formula | C30H35FN2O2S |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (2R)-2-[3-benzylsulfanylpropanoyl-[(2-fluorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C30H35FN2O2S/c1-2-3-19-32-30(35)28(21-24-12-6-4-7-13-24)33(22-26-16-10-11-17-27(26)31)29(34)18-20-36-23-25-14-8-5-9-15-25/h4-17,28H,2-3,18-23H2,1H3,(H,32,35)/t28-/m1/s1 |
| InChIKey | UUBWFZXUSXVYET-MUUNZHRXSA-N |
| XLogP | 6.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|