C31H37FN2O2S — CID 100642468
(2R)-N-butyl-2-[[2-[(3,5-dimethylphenyl)methylsulfanyl]acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100642468) has the molecular formula C31H37FN2O2S and a molecular weight of 520.71 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-[(3,5-dimethylphenyl)methylsulfanyl]acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-[(3,5-dimethylphenyl)methylsulfanyl]acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100642468 |
| Molecular Formula | C31H37FN2O2S |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2R)-N-butyl-2-[[2-[(3,5-dimethylphenyl)methylsulfanyl]acetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CSCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C31H37FN2O2S/c1-4-5-15-33-31(36)29(19-25-11-7-6-8-12-25)34(20-27-13-9-10-14-28(27)32)30(35)22-37-21-26-17-23(2)16-24(3)18-26/h6-14,16-18,29H,4-5,15,19-22H2,1-3H3,(H,33,36)/t29-/m1/s1 |
| InChIKey | YOVOQPDRMAJHLA-GDLZYMKVSA-N |
| XLogP | 6.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|