C28H31FN2O2S — CID 132616497
2-[(2-benzylsulfanylacetyl)-[(2-fluorophenyl)methyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 132616497) has the molecular formula C28H31FN2O2S and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[(2-benzylsulfanylacetyl)-[(2-fluorophenyl)methyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[(2-benzylsulfanylacetyl)-[(2-fluorophenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 132616497 |
| Molecular Formula | C28H31FN2O2S |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-[(2-benzylsulfanylacetyl)-[(2-fluorophenyl)methyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C28H31FN2O2S/c1-2-17-30-28(33)26(18-22-11-5-3-6-12-22)31(19-24-15-9-10-16-25(24)29)27(32)21-34-20-23-13-7-4-8-14-23/h3-16,26H,2,17-21H2,1H3,(H,30,33) |
| InChIKey | YBVSVDQYIYWIFB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |