C30H34Cl2N2O2 — CID 133204436
N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide (PubChem CID 133204436) has the molecular formula C30H34Cl2N2O2 and a molecular weight of 525.52 g/mol. Its IUPAC name is N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204436 |
| Molecular Formula | C30H34Cl2N2O2 |
| Molecular Weight | 525.52 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C30H34Cl2N2O2/c1-4-5-16-33-30(36)28(18-23-10-7-6-8-11-23)34(20-25-26(31)12-9-13-27(25)32)29(35)19-24-17-21(2)14-15-22(24)3/h6-15,17,28H,4-5,16,18-20H2,1-3H3,(H,33,36) |
| InChIKey | YJVUTDUNMFINEX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|