C30H35BrN2O2 — CID 100678875
(2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100678875) has the molecular formula C30H35BrN2O2 and a molecular weight of 535.53 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100678875 |
| Molecular Formula | C30H35BrN2O2 |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,5-dimethylphenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C30H35BrN2O2/c1-4-5-17-32-30(35)28(19-24-9-7-6-8-10-24)33(21-25-13-15-27(31)16-14-25)29(34)20-26-18-22(2)11-12-23(26)3/h6-16,18,28H,4-5,17,19-21H2,1-3H3,(H,32,35)/t28-/m0/s1 |
| InChIKey | MOKZGHFTMAUXNF-NDEPHWFRSA-N |
| XLogP | 6.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|