C28H28Cl3FN2O2 — CID 133204493
N-butyl-2-[[2-(2-chloro-6-fluorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133204493) has the molecular formula C28H28Cl3FN2O2 and a molecular weight of 549.90 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-chloro-6-fluorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(2-chloro-6-fluorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204493 |
| Molecular Formula | C28H28Cl3FN2O2 |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | N-butyl-2-[[2-(2-chloro-6-fluorophenyl)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C28H28Cl3FN2O2/c1-2-3-15-33-28(36)26(16-19-9-5-4-6-10-19)34(18-21-23(30)11-7-12-24(21)31)27(35)17-20-22(29)13-8-14-25(20)32/h4-14,26H,2-3,15-18H2,1H3,(H,33,36) |
| InChIKey | ROKVXYNHMLVNGH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|