C28H29BrClFN2O2 — CID 133206643
2-[(4-bromophenyl)methyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206643) has the molecular formula C28H29BrClFN2O2 and a molecular weight of 559.91 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206643 |
| Molecular Formula | C28H29BrClFN2O2 |
| Molecular Weight | 559.91 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(2-chloro-6-fluorophenyl)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C28H29BrClFN2O2/c1-2-3-16-32-28(35)26(17-20-8-5-4-6-9-20)33(19-21-12-14-22(29)15-13-21)27(34)18-23-24(30)10-7-11-25(23)31/h4-15,26H,2-3,16-19H2,1H3,(H,32,35) |
| InChIKey | NFBNIGYUBGROQU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.91 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|