C24H29ClN2O4 — CID 133151474
2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 133151474) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151474 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)propanoyl-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H29ClN2O4/c1-3-4-12-26-24(29)17(2)27(15-19-6-5-7-20(25)13-19)23(28)11-9-18-8-10-21-22(14-18)31-16-30-21/h5-8,10,13-14,17H,3-4,9,11-12,15-16H2,1-2H3,(H,26,29) |
| InChIKey | UQQJJGDIJYVDIK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|