C28H30ClFN2O2S — CID 100642358
(2S)-N-butyl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100642358) has the molecular formula C28H30ClFN2O2S and a molecular weight of 513.08 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100642358 |
| Molecular Formula | C28H30ClFN2O2S |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(4-chlorophenyl)sulfanylacetyl]-[(2-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30ClFN2O2S/c1-2-3-17-31-28(34)26(18-21-9-5-4-6-10-21)32(19-22-11-7-8-12-25(22)30)27(33)20-35-24-15-13-23(29)14-16-24/h4-16,26H,2-3,17-20H2,1H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | RQLNNMKIRDVIEG-SANMLTNESA-N |
| XLogP | 6.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|