C32H35N3O5 — CID 133201145
4-(1,3-dioxoisoindol-2-yl)-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide (PubChem CID 133201145) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 133201145 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(3-methoxyphenyl)methyl]-N-[1-oxo-3-phenyl-1-(propylamino)propan-2-yl]butanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H35N3O5/c1-3-18-33-30(37)28(21-23-11-5-4-6-12-23)35(22-24-13-9-14-25(20-24)40-2)29(36)17-10-19-34-31(38)26-15-7-8-16-27(26)32(34)39/h4-9,11-16,20,28H,3,10,17-19,21-22H2,1-2H3,(H,33,37) |
| InChIKey | AXSFEWNICUOVFO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|