C28H35N3O5 — CID 132618554
N-tert-butyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132618554) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-tert-butyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132618554 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | N-tert-butyl-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(Cc1cccc(OC)c1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H35N3O5/c1-6-23(25(33)29-28(2,3)4)31(18-19-11-9-12-20(17-19)36-5)24(32)15-10-16-30-26(34)21-13-7-8-14-22(21)27(30)35/h7-9,11-14,17,23H,6,10,15-16,18H2,1-5H3,(H,29,33) |
| InChIKey | AEVZRMOQIGUPIJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|