C36H39N3O4 — CID 100712250
N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]-4-(2-oxobenzo[cd]indol-1-yl)butanamide (PubChem CID 100712250) has the molecular formula C36H39N3O4 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]-4-(2-oxobenzo[cd]indol-1-yl)butanamide.
| Compound Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]-4-(2-oxobenzo[cd]indol-1-yl)butanamide |
|---|---|
| PubChem CID | 100712250 |
| Molecular Formula | C36H39N3O4 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-[(2R)-1-(butylamino)-1-oxo-3-phenylpropan-2-yl]-N-[(3-methoxyphenyl)methyl]-4-(2-oxobenzo[cd]indol-1-yl)butanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CCCN1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C36H39N3O4/c1-3-4-21-37-35(41)32(24-26-12-6-5-7-13-26)39(25-27-14-8-17-29(23-27)43-2)33(40)20-11-22-38-31-19-10-16-28-15-9-18-30(34(28)31)36(38)42/h5-10,12-19,23,32H,3-4,11,20-22,24-25H2,1-2H3,(H,37,41)/t32-/m1/s1 |
| InChIKey | HEZOTSTVZLIDIN-JGCGQSQUSA-N |
| XLogP | 6.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|