C27H32FN3O4 — CID 100714248
(2S)-N-[(2S)-butan-2-yl]-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide (PubChem CID 100714248) has the molecular formula C27H32FN3O4 and a molecular weight of 481.57 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 100714248 |
| Molecular Formula | C27H32FN3O4 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-fluorophenyl)methyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1ccc(F)cc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H32FN3O4/c1-4-18(3)29-25(33)23(5-2)31(17-19-12-14-20(28)15-13-19)24(32)11-8-16-30-26(34)21-9-6-7-10-22(21)27(30)35/h6-7,9-10,12-15,18,23H,4-5,8,11,16-17H2,1-3H3,(H,29,33)/t18-,23-/m0/s1 |
| InChIKey | VEMJBGSKLWQQTP-MBSDFSHPSA-N |
| XLogP | 3.92 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|