C27H33N3O4 — CID 132676501
2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-methylphenyl)methyl]amino]-N-propan-2-ylbutanamide (PubChem CID 132676501) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-methylphenyl)methyl]amino]-N-propan-2-ylbutanamide.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-methylphenyl)methyl]amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 132676501 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)butanoyl-[(4-methylphenyl)methyl]amino]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)N(Cc1ccc(C)cc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H33N3O4/c1-5-23(25(32)28-18(2)3)30(17-20-14-12-19(4)13-15-20)24(31)11-8-16-29-26(33)21-9-6-7-10-22(21)27(29)34/h6-7,9-10,12-15,18,23H,5,8,11,16-17H2,1-4H3,(H,28,32) |
| InChIKey | BZCNWBHXSMLZIP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|