C26H31N3O5 — CID 100719607
4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide (PubChem CID 100719607) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 100719607 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-methoxyphenyl)methyl]-N-[(2S)-1-oxo-1-(propan-2-ylamino)propan-2-yl]butanamide |
| SMILES | COc1ccc(CN(C(=O)CCCN2C(=O)c3ccccc3C2=O)[C@@H](C)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-17(2)27-24(31)18(3)29(16-19-11-13-20(34-4)14-12-19)23(30)10-7-15-28-25(32)21-8-5-6-9-22(21)26(28)33/h5-6,8-9,11-14,17-18H,7,10,15-16H2,1-4H3,(H,27,31)/t18-/m0/s1 |
| InChIKey | URRRELNUFWBLOJ-SFHVURJKSA-N |
| XLogP | 3.01 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|