C23H24BrN3O4 — CID 100653039
N-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]butanamide (PubChem CID 100653039) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 100653039 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]butanamide |
| SMILES | CNC(=O)[C@@H](C)N(Cc1ccc(Br)cc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24BrN3O4/c1-15(21(29)25-2)27(14-16-9-11-17(24)12-10-16)20(28)8-5-13-26-22(30)18-6-3-4-7-19(18)23(26)31/h3-4,6-7,9-12,15H,5,8,13-14H2,1-2H3,(H,25,29)/t15-/m1/s1 |
| InChIKey | JBVGYHNYRKULSD-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|