C28H32BrN3O4 — CID 100569932
N-[(4-bromophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 100569932) has the molecular formula C28H32BrN3O4 and a molecular weight of 554.49 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 100569932 |
| Molecular Formula | C28H32BrN3O4 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)N(Cc1ccc(Br)cc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H32BrN3O4/c1-19(26(34)30-22-8-3-2-4-9-22)32(18-20-13-15-21(29)16-14-20)25(33)12-7-17-31-27(35)23-10-5-6-11-24(23)28(31)36/h5-6,10-11,13-16,19,22H,2-4,7-9,12,17-18H2,1H3,(H,30,34)/t19-/m0/s1 |
| InChIKey | ZEBSFENUKWRNPU-IBGZPJMESA-N |
| XLogP | 4.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|