C25H28FN3O4 — CID 132675366
4-(1,3-dioxoisoindol-2-yl)-N-[(4-fluorophenyl)methyl]-N-[1-oxo-1-(propylamino)propan-2-yl]butanamide (PubChem CID 132675366) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(4-fluorophenyl)methyl]-N-[1-oxo-1-(propylamino)propan-2-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-fluorophenyl)methyl]-N-[1-oxo-1-(propylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 132675366 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-fluorophenyl)methyl]-N-[1-oxo-1-(propylamino)propan-2-yl]butanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1ccc(F)cc1)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H28FN3O4/c1-3-14-27-23(31)17(2)29(16-18-10-12-19(26)13-11-18)22(30)9-6-15-28-24(32)20-7-4-5-8-21(20)25(28)33/h4-5,7-8,10-13,17H,3,6,9,14-16H2,1-2H3,(H,27,31) |
| InChIKey | CLADYNAZICVTCA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|