C25H27Cl2N3O4 — CID 100501761
N-[(2,4-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]butanamide (PubChem CID 100501761) has the molecular formula C25H27Cl2N3O4 and a molecular weight of 504.41 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]butanamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 100501761 |
| Molecular Formula | C25H27Cl2N3O4 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[(2R)-1-oxo-1-(propylamino)propan-2-yl]butanamide |
| SMILES | CCCNC(=O)[C@@H](C)N(Cc1ccc(Cl)cc1Cl)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H27Cl2N3O4/c1-3-12-28-23(32)16(2)30(15-17-10-11-18(26)14-21(17)27)22(31)9-6-13-29-24(33)19-7-4-5-8-20(19)25(29)34/h4-5,7-8,10-11,14,16H,3,6,9,12-13,15H2,1-2H3,(H,28,32)/t16-/m1/s1 |
| InChIKey | JYQXEXCDXPDARA-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|