C24H26ClN3O4 — CID 132675518
N-[(2-chlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[1-(ethylamino)-1-oxopropan-2-yl]butanamide (PubChem CID 132675518) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[1-(ethylamino)-1-oxopropan-2-yl]butanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[1-(ethylamino)-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 132675518 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)-N-[1-(ethylamino)-1-oxopropan-2-yl]butanamide |
| SMILES | CCNC(=O)C(C)N(Cc1ccccc1Cl)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H26ClN3O4/c1-3-26-22(30)16(2)28(15-17-9-4-7-12-20(17)25)21(29)13-8-14-27-23(31)18-10-5-6-11-19(18)24(27)32/h4-7,9-12,16H,3,8,13-15H2,1-2H3,(H,26,30) |
| InChIKey | LFJYBZRZPFWGTM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|